C26H18F6O6S — CID 121447823
5-[4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonic acid (PubChem CID 121447823) has the molecular formula C26H18F6O6S and a molecular weight of 572.48 g/mol. Its IUPAC name is 5-[4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonic acid.
| Compound Name | 5-[4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 121447823 |
| Molecular Formula | C26H18F6O6S |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 5-[4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1ccc(-c2cccc3c(S(=O)(=O)O)cccc23)c2ccccc12 |
| InChI | InChI=1S/C26H18F6O6S/c27-25(28,29)24(34,26(30,31)32)13-14-38-23(33)21-12-11-19(15-5-1-2-6-18(15)21)16-7-3-9-20-17(16)8-4-10-22(20)39(35,36)37/h1-12,34H,13-14H2,(H,35,36,37) |
| InChIKey | CQRBOKRURZLTDA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|