C42H46F12O13S — CID 121448030
3,5-bis[[3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-1-adamantyl]methoxycarbonyl]benzenesulfonic acid (PubChem CID 121448030) has the molecular formula C42H46F12O13S and a molecular weight of 1018.86 g/mol. Its IUPAC name is 3,5-bis[[3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-1-adamantyl]methoxycarbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[[3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-1-adamantyl]methoxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 121448030 |
| Molecular Formula | C42H46F12O13S |
| Molecular Weight | 1018.86 g/mol |
| Exact Mass | 1018.25 |
| IUPAC Name | 3,5-bis[[3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-1-adamantyl]methoxycarbonyl]benzenesulfonic acid |
| SMILES | O=C(OCC12CC3CC(C1)CC(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)(C3)C2)c1cc(C(=O)OCC23CC4CC(C2)CC(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)(C4)C3)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C42H46F12O13S/c43-39(44,45)37(59,40(46,47)48)1-3-64-31(57)35-14-22-5-23(15-35)11-33(10-22,18-35)20-66-29(55)26-7-27(9-28(8-26)68(61,62)63)30(56)67-21-34-12-24-6-25(13-34)17-36(16-24,19-34)32(58)65-4-2-38(60,41(49,50)51)42(52,53)54/h7-9,22-25,59-60H,1-6,10-21H2,(H,61,62,63) |
| InChIKey | GCTAHQXCNCOORU-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.86 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|