C24H32O5 — CID 121448188
methyl (1R,2R,12S)-5,5-dimethyl-13-methylidene-14-oxo-2-prop-2-enoyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate (PubChem CID 121448188) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl (1R,2R,12S)-5,5-dimethyl-13-methylidene-14-oxo-2-prop-2-enoyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,12S)-5,5-dimethyl-13-methylidene-14-oxo-2-prop-2-enoyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
|---|---|
| PubChem CID | 121448188 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | methyl (1R,2R,12S)-5,5-dimethyl-13-methylidene-14-oxo-2-prop-2-enoyloxytetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
| SMILES | C=CC(=O)O[C@@H]1CC2C(C)(C)CCCC2(C(=O)OC)C2C[C@@H]3CC[C@@]21C(=O)C3=C |
| InChI | InChI=1S/C24H32O5/c1-6-19(25)29-18-13-16-22(3,4)9-7-10-23(16,21(27)28-5)17-12-15-8-11-24(17,18)20(26)14(15)2/h6,15-18H,1-2,7-13H2,3-5H3/t15-,16?,17?,18+,23?,24+/m0/s1 |
| InChIKey | MHBZNYNCKKRWJE-CIRKQWFASA-N |
| XLogP | 4.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|