C27H33ClO6S — CID 121448200
[(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 4-chlorobenzenesulfonate (PubChem CID 121448200) has the molecular formula C27H33ClO6S and a molecular weight of 521.08 g/mol. Its IUPAC name is [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 4-chlorobenzenesulfonate.
| Compound Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 121448200 |
| Molecular Formula | C27H33ClO6S |
| Molecular Weight | 521.08 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 4-chlorobenzenesulfonate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(CCCC)C(=O)OC[C@@H](C)C1C[C@H]3OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H33ClO6S/c1-4-5-11-26-21(16(2)15-33-25(26)30)14-23(34-35(31,32)20-8-6-19(28)7-9-20)27-12-10-18(13-22(26)27)17(3)24(27)29/h6-9,16,18,21-23H,3-5,10-15H2,1-2H3/t16-,18+,21?,22?,23-,26?,27-/m1/s1 |
| InChIKey | JIPDVXMZCMGFPK-JCFCKJSESA-N |
| XLogP | 5.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|