C28H36O6S — CID 121448225
methyl (1R,2R,12S)-2-benzylsulfonyloxy-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate (PubChem CID 121448225) has the molecular formula C28H36O6S and a molecular weight of 500.66 g/mol. Its IUPAC name is methyl (1R,2R,12S)-2-benzylsulfonyloxy-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,12S)-2-benzylsulfonyloxy-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
|---|---|
| PubChem CID | 121448225 |
| Molecular Formula | C28H36O6S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | methyl (1R,2R,12S)-2-benzylsulfonyloxy-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(C(=O)OC)CCCC(C)(C)C1C[C@H]3OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C28H36O6S/c1-18-20-11-14-28(24(18)29)22(15-20)27(25(30)33-4)13-8-12-26(2,3)21(27)16-23(28)34-35(31,32)17-19-9-6-5-7-10-19/h5-7,9-10,20-23H,1,8,11-17H2,2-4H3/t20-,21?,22?,23+,27?,28+/m0/s1 |
| InChIKey | PKPBKDFLRVLJMC-JPUAYFPISA-N |
| XLogP | 4.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|