C23H29F3O5 — CID 121448226
[(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 121448226) has the molecular formula C23H29F3O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 121448226 |
| Molecular Formula | C23H29F3O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(CCCC)C(=O)OC[C@@H](C)C1C[C@H]3OC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H29F3O5/c1-4-5-7-21-15(12(2)11-30-19(21)28)10-17(31-20(29)23(24,25)26)22-8-6-14(9-16(21)22)13(3)18(22)27/h12,14-17H,3-11H2,1-2H3/t12-,14+,15?,16?,17-,21?,22-/m1/s1 |
| InChIKey | AQLFNOKDNKBNJQ-PLRFESBSSA-N |
| XLogP | 4.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|