C27H34O6S — CID 121448234
methyl (1R,2R,12S)-2-(benzenesulfonyloxy)-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate (PubChem CID 121448234) has the molecular formula C27H34O6S and a molecular weight of 486.63 g/mol. Its IUPAC name is methyl (1R,2R,12S)-2-(benzenesulfonyloxy)-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,12S)-2-(benzenesulfonyloxy)-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
|---|---|
| PubChem CID | 121448234 |
| Molecular Formula | C27H34O6S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | methyl (1R,2R,12S)-2-(benzenesulfonyloxy)-5,5-dimethyl-13-methylidene-14-oxotetracyclo[10.2.2.01,10.04,9]hexadecane-9-carboxylate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(C(=O)OC)CCCC(C)(C)C1C[C@H]3OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34O6S/c1-17-18-11-14-27(23(17)28)21(15-18)26(24(29)32-4)13-8-12-25(2,3)20(26)16-22(27)33-34(30,31)19-9-6-5-7-10-19/h5-7,9-10,18,20-22H,1,8,11-16H2,2-4H3/t18-,20?,21?,22+,26?,27+/m0/s1 |
| InChIKey | SZUNJQBPXCBMFD-NMPGKKNJSA-N |
| XLogP | 4.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|