C30H36O5 — CID 121448282
[(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 121448282) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 121448282 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [(1R,2R,5S,12S)-9-butyl-5-methyl-13-methylidene-8,14-dioxo-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(CCCC)C(=O)OC[C@@H](C)C1C[C@H]3OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H36O5/c1-4-5-14-29-23(19(2)18-34-28(29)33)17-25(35-26(31)12-11-21-9-7-6-8-10-21)30-15-13-22(16-24(29)30)20(3)27(30)32/h6-12,19,22-25H,3-5,13-18H2,1-2H3/b12-11+/t19-,22+,23?,24?,25-,29?,30-/m1/s1 |
| InChIKey | RPNHADHZBBROAH-OIYHBXDLSA-N |
| XLogP | 5.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|