C20H29ClN4O3 — CID 121448672
5-[3-[4-[(3E,5Z)-7-chlorohepta-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 121448672) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is 5-[3-[4-[(3E,5Z)-7-chlorohepta-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-[(3E,5Z)-7-chlorohepta-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121448672 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-[3-[4-[(3E,5Z)-7-chlorohepta-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | C=C/C(=C\C=C/CCl)N1CCN(C(=O)CCC2(C(C)C)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C20H29ClN4O3/c1-4-16(7-5-6-10-21)24-11-13-25(14-12-24)17(26)8-9-20(15(2)3)18(27)22-19(28)23-20/h4-7,15H,1,8-14H2,2-3H3,(H2,22,23,27,28)/b6-5-,16-7+ |
| InChIKey | RTXBZDDWRXQBDO-DKPKDLPHSA-N |
| XLogP | 2.01 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|