C21H25FO5 — CID 121448694
(14R,16S)-9-fluoro-11-hydroxy-10,13,16-trimethylspiro[6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,4'-dioxetane]-3,3'-dione (PubChem CID 121448694) has the molecular formula C21H25FO5 and a molecular weight of 376.42 g/mol. Its IUPAC name is (14R,16S)-9-fluoro-11-hydroxy-10,13,16-trimethylspiro[6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,4'-dioxetane]-3,3'-dione.
| Compound Name | (14R,16S)-9-fluoro-11-hydroxy-10,13,16-trimethylspiro[6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,4'-dioxetane]-3,3'-dione |
|---|---|
| PubChem CID | 121448694 |
| Molecular Formula | C21H25FO5 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (14R,16S)-9-fluoro-11-hydroxy-10,13,16-trimethylspiro[6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,4'-dioxetane]-3,3'-dione |
| SMILES | CC1C[C@@H]2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C12OOC2=O |
| InChI | InChI=1S/C21H25FO5/c1-11-8-15-14-5-4-12-9-13(23)6-7-18(12,2)20(14,22)16(24)10-19(15,3)21(11)17(25)26-27-21/h6-7,9,11,14-16,24H,4-5,8,10H2,1-3H3/t11?,14?,15-,16?,18?,19?,20?,21?/m1/s1 |
| InChIKey | HCCDLJZFKZXOJB-LELODMKXSA-N |
| XLogP | 2.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|