C18H26N2O2 — CID 121449060
5-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]hexane-1,4-dione (PubChem CID 121449060) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]hexane-1,4-dione.
| Compound Name | 5-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]hexane-1,4-dione |
|---|---|
| PubChem CID | 121449060 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 5-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]hexane-1,4-dione |
| SMILES | Cc1ccccc1N1CCN(C(=O)CCC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-14(2)17(21)8-9-18(22)20-12-10-19(11-13-20)16-7-5-4-6-15(16)3/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | HHSXROGSCAQQFO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |