C28H32N2O7 — CID 121449799
4-[(3-benzyl-2,4-dioxo-5-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2,2-dimethylbutanoate (PubChem CID 121449799) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is 4-[(3-benzyl-2,4-dioxo-5-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2,2-dimethylbutanoate.
| Compound Name | 4-[(3-benzyl-2,4-dioxo-5-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121449799 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 4-[(3-benzyl-2,4-dioxo-5-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCOC(=O)Oc1[nH]c(=O)n(Cc2ccccc2)c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C28H32N2O7/c1-4-28(2,3)25(32)35-17-11-12-18-36-27(34)37-23-22(21-15-9-6-10-16-21)24(31)30(26(33)29-23)19-20-13-7-5-8-14-20/h5-10,13-16H,4,11-12,17-19H2,1-3H3,(H,29,33) |
| InChIKey | YJSROXHBRQNCDR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|