C33H34N2O7 — CID 121449801
2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2,2-dimethylbutanoate (PubChem CID 121449801) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121449801 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)Oc1c(Cc2ccccc2)c(=O)n(-c2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C33H34N2O7/c1-4-33(2,3)30(37)40-20-21-41-32(39)42-29-27(22-24-14-8-5-9-15-24)28(36)35(26-18-12-7-13-19-26)31(38)34(29)23-25-16-10-6-11-17-25/h5-19H,4,20-23H2,1-3H3 |
| InChIKey | LGYUOMQQWWTGOQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|