About 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate
2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate (PubChem CID 121449808) has the molecular formula C32H32N2O7
and a molecular weight of 556.62 g/mol. Its IUPAC name is 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate |
| PubChem CID | 121449808 |
| Molecular Formula | C32H32N2O7 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(=O)Oc1c(Cc2ccccc2)c(=O)n(-c2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C32H32N2O7/c1-3-23(2)30(36)39-19-20-40-32(38)41-29-27(21-24-13-7-4-8-14-24)28(35)34(26-17-11-6-12-18-26)31(37)33(29)22-25-15-9-5-10-16-25/h4-18,23H,3,19-22H2,1-2H3 |
| InChIKey | UJPIQWRYZJBDQP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate?
The IUPAC name of 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate (CID 121449808) is 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate.
What is the SMILES notation for 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate?
The canonical SMILES for 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate is CCC(C)C(=O)OCCOC(=O)Oc1c(Cc2ccccc2)c(=O)n(-c2ccccc2)c(=O)n1Cc1ccccc1.
What is the InChIKey of 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate?
The InChIKey is UJPIQWRYZJBDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32N2O7/c1-3-23(2)30(36)39-19-20-40-32(38)41-29-27(21-24-13-7-4-8-14-24)28(35)34(26-17-11-6-12-18-26)31(37)33(29)22-25-15-9-5-10-16-25/h4-18,23H,3,19-22H2,1-2H3.
What are the key properties of 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate?
2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate has a molecular weight of 556.62 g/mol, XLogP of 4.74, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl)oxycarbonyloxyethyl 2-methylbutanoate is sourced from PubChem (CID 121449808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).