About 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate
4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate (PubChem CID 121449809) has the molecular formula C35H36N2O8
and a molecular weight of 612.68 g/mol. Its IUPAC name is 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate |
| PubChem CID | 121449809 |
| Molecular Formula | C35H36N2O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate |
| SMILES | CCC(C)C(=O)OCCOC(=O)CCC(=O)Oc1c(Cc2ccccc2)c(=O)n(-c2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C35H36N2O8/c1-3-25(2)34(41)44-22-21-43-30(38)19-20-31(39)45-33-29(23-26-13-7-4-8-14-26)32(40)37(28-17-11-6-12-18-28)35(42)36(33)24-27-15-9-5-10-16-27/h4-18,25H,3,19-24H2,1-2H3 |
| InChIKey | DQINPUAKMBMYEL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 122.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate?
The IUPAC name of 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate (CID 121449809) is 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate.
What is the SMILES notation for 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate?
The canonical SMILES for 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate is CCC(C)C(=O)OCCOC(=O)CCC(=O)Oc1c(Cc2ccccc2)c(=O)n(-c2ccccc2)c(=O)n1Cc1ccccc1.
What is the InChIKey of 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate?
The InChIKey is DQINPUAKMBMYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H36N2O8/c1-3-25(2)34(41)44-22-21-43-30(38)19-20-31(39)45-33-29(23-26-13-7-4-8-14-26)32(40)37(28-17-11-6-12-18-28)35(42)36(33)24-27-15-9-5-10-16-27/h4-18,25H,3,19-24H2,1-2H3.
What are the key properties of 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate?
4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate has a molecular weight of 612.68 g/mol, XLogP of 4.46, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(3,5-dibenzyl-2,6-dioxo-1-phenylpyrimidin-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate is sourced from PubChem (CID 121449809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).