C33H34N2O6 — CID 121449824
[4-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxy-4-oxobutyl] 2-methylbutanoate (PubChem CID 121449824) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is [4-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxy-4-oxobutyl] 2-methylbutanoate.
| Compound Name | [4-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxy-4-oxobutyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 121449824 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [4-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxy-4-oxobutyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCC(=O)Oc1c(Cc2ccccc2)c(=O)n(Cc2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C33H34N2O6/c1-3-24(2)32(38)40-21-13-20-29(36)41-31-28(22-25-14-7-4-8-15-25)30(37)34(23-26-16-9-5-10-17-26)33(39)35(31)27-18-11-6-12-19-27/h4-12,14-19,24H,3,13,20-23H2,1-2H3 |
| InChIKey | IXMUMLQZLOBGBN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|