C28H33N3O9S2 — CID 121449904
2-[1-[(2R)-2-(4-hydroxycyclohexyl)oxy-2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid (PubChem CID 121449904) has the molecular formula C28H33N3O9S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is 2-[1-[(2R)-2-(4-hydroxycyclohexyl)oxy-2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-[(2R)-2-(4-hydroxycyclohexyl)oxy-2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121449904 |
| Molecular Formula | C28H33N3O9S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | 2-[1-[(2R)-2-(4-hydroxycyclohexyl)oxy-2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid |
| SMILES | COc1ccccc1[C@H](CN1c2sc(-c3ncco3)c(C)c2C(=O)N(C(C)(C)C(=O)O)S1(=O)=O)OC1CCC(O)CC1 |
| InChI | InChI=1S/C28H33N3O9S2/c1-16-22-25(33)31(28(2,3)27(34)35)42(36,37)30(26(22)41-23(16)24-29-13-14-39-24)15-21(19-7-5-6-8-20(19)38-4)40-18-11-9-17(32)10-12-18/h5-8,13-14,17-18,21,32H,9-12,15H2,1-4H3,(H,34,35)/t17?,18?,21-/m0/s1 |
| InChIKey | MMENGMSWGXBSTL-NGICGMGXSA-N |
| XLogP | 4.15 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |