C25H44O6 — CID 121450077
trans-(4R,5R)-4-hydroxy-5-[(2E,6E)-12-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-2,3,3-trimethoxy-6-methylcyclohexan-1-one (PubChem CID 121450077) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is trans-(4R,5R)-4-hydroxy-5-[(2E,6E)-12-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-2,3,3-trimethoxy-6-methylcyclohexan-1-one.
| Compound Name | trans-(4R,5R)-4-hydroxy-5-[(2E,6E)-12-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-2,3,3-trimethoxy-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 121450077 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | trans-(4R,5R)-4-hydroxy-5-[(2E,6E)-12-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-2,3,3-trimethoxy-6-methylcyclohexan-1-one |
| SMILES | COC1C(=O)C(C)[C@@H](C/C=C(\C)CC/C=C(\C)CCCC(C)CO)[C@@H](O)C1(OC)OC |
| InChI | InChI=1S/C25H44O6/c1-17(11-9-13-19(3)16-26)10-8-12-18(2)14-15-21-20(4)22(27)24(29-5)25(30-6,31-7)23(21)28/h10,14,19-21,23-24,26,28H,8-9,11-13,15-16H2,1-7H3/b17-10+,18-14+/t19?,20?,21-,23-,24?/m1/s1 |
| InChIKey | ORPAHMYOJQRTCF-NJZNJTRTSA-N |
| XLogP | 4.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|