About (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone
(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone (PubChem CID 121450286) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone.
Molecular Properties
| Compound Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone |
| PubChem CID | 121450286 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone |
| SMILES | CC(C)(C)C1=CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H27NO/c1-16(2,3)14-9-11-17(12-10-14)15(18)13-7-5-4-6-8-13/h9,13H,4-8,10-12H2,1-3H3 |
| InChIKey | NHJVJTBRJOIBST-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone?
The IUPAC name of (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone (CID 121450286) is (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone.
What is the SMILES notation for (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone?
The canonical SMILES for (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone is CC(C)(C)C1=CCN(C(=O)C2CCCCC2)CC1.
What is the InChIKey of (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone?
The InChIKey is NHJVJTBRJOIBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-16(2,3)14-9-11-17(12-10-14)15(18)13-7-5-4-6-8-13/h9,13H,4-8,10-12H2,1-3H3.
What are the key properties of (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone?
(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone has a molecular weight of 249.40 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-cyclohexylmethanone is sourced from PubChem (CID 121450286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).