About 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole
2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole (PubChem CID 121450551) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 121450551 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=CCC(CCC2=NCCN2)C=C1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11/h1-4,10H,5-9H2,(H,12,13) |
| InChIKey | ILXSZZRMHCNBBQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole (CID 121450551) is 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole is C1=CCC(CCC2=NCCN2)C=C1.
What is the InChIKey of 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is ILXSZZRMHCNBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11/h1-4,10H,5-9H2,(H,12,13).
What are the key properties of 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole?
2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 176.26 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexa-2,4-dien-1-ylethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 121450551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).