C56H44N2 — CID 121450570
9,9-dimethyl-N-[4-(1-methyl-2,4,5-triphenylpyrrol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 121450570) has the molecular formula C56H44N2 and a molecular weight of 744.98 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-(1-methyl-2,4,5-triphenylpyrrol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-(1-methyl-2,4,5-triphenylpyrrol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 121450570 |
| Molecular Formula | C56H44N2 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | 9,9-dimethyl-N-[4-(1-methyl-2,4,5-triphenylpyrrol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)c(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C56H44N2/c1-56(2)50-27-17-16-26-48(50)49-37-36-47(38-51(49)56)58(45-32-28-40(29-33-45)39-18-8-4-9-19-39)46-34-30-42(31-35-46)53-52(41-20-10-5-11-21-41)54(43-22-12-6-13-23-43)57(3)55(53)44-24-14-7-15-25-44/h4-38H,1-3H3 |
| InChIKey | HFNPFRRQKIKVSO-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |