C52H41N3 — CID 121450619
N'-[(2S)-2-amino-1-[3-[4-(9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2-phenylethyl]benzenecarboximidamide (PubChem CID 121450619) has the molecular formula C52H41N3 and a molecular weight of 707.92 g/mol. Its IUPAC name is N'-[(2S)-2-amino-1-[3-[4-(9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2-phenylethyl]benzenecarboximidamide.
| Compound Name | N'-[(2S)-2-amino-1-[3-[4-(9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2-phenylethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 121450619 |
| Molecular Formula | C52H41N3 |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | N'-[(2S)-2-amino-1-[3-[4-(9,9-diphenylfluoren-3-yl)phenyl]phenyl]-2-phenylethyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(c1cccc(-c2ccc(-c3ccc4c(c3)-c3ccccc3C4(c3ccccc3)c3ccccc3)cc2)c1)[C@@H](N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H41N3/c53-49(38-16-5-1-6-17-38)50(55-51(54)39-18-7-2-8-19-39)42-21-15-20-40(34-42)36-28-30-37(31-29-36)41-32-33-48-46(35-41)45-26-13-14-27-47(45)52(48,43-22-9-3-10-23-43)44-24-11-4-12-25-44/h1-35,49-50H,53H2,(H2,54,55)/t49-,50?/m0/s1 |
| InChIKey | SATUADJYPRLFLD-OKFYPZDCSA-N |
| XLogP | 11.53 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|