C43H32N2 — CID 121450715
4-[4-[3-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 121450715) has the molecular formula C43H32N2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 4-[4-[3-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[3-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 121450715 |
| Molecular Formula | C43H32N2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 4-[4-[3-(9,9-dimethylfluoren-4-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3cccc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c3)cccc21 |
| InChI | InChI=1S/C43H32N2/c1-43(2)37-21-10-9-19-36(37)41-35(20-12-22-38(41)43)34-18-11-17-33(27-34)29-23-25-31(26-24-29)40-28-39(30-13-5-3-6-14-30)44-42(45-40)32-15-7-4-8-16-32/h3-28H,1-2H3 |
| InChIKey | GTHDMPBVJYXWQB-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |