C11H14O4 — CID 121450828
(3R,3aS,4R,5S,7aR)-3,5-dimethyl-1,6-dioxo-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carbaldehyde (PubChem CID 121450828) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3R,3aS,4R,5S,7aR)-3,5-dimethyl-1,6-dioxo-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carbaldehyde.
| Compound Name | (3R,3aS,4R,5S,7aR)-3,5-dimethyl-1,6-dioxo-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 121450828 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3R,3aS,4R,5S,7aR)-3,5-dimethyl-1,6-dioxo-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carbaldehyde |
| SMILES | C[C@@H]1C(=O)C[C@H]2C(=O)O[C@H](C)[C@H]2[C@H]1C=O |
| InChI | InChI=1S/C11H14O4/c1-5-8(4-12)10-6(2)15-11(14)7(10)3-9(5)13/h4-8,10H,3H2,1-2H3/t5-,6+,7+,8-,10+/m0/s1 |
| InChIKey | YOLIIJZTTRZSIK-IWYOCHMKSA-N |
| XLogP | 0.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|