C10H16F5N — CID 121451126
(E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine (PubChem CID 121451126) has the molecular formula C10H16F5N and a molecular weight of 245.23 g/mol. Its IUPAC name is (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine.
| Compound Name | (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine |
|---|---|
| PubChem CID | 121451126 |
| Molecular Formula | C10H16F5N |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine |
| SMILES | C/C(=C\CCC(C)NCC(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F5N/c1-7(10(13,14)15)4-3-5-8(2)16-6-9(11)12/h4,8-9,16H,3,5-6H2,1-2H3/b7-4+ |
| InChIKey | CRYSSCAFPPNZTL-QPJJXVBHSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|