C10H13F8N — CID 121451127
N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-(trifluoromethyl)hept-5-en-2-amine (PubChem CID 121451127) has the molecular formula C10H13F8N and a molecular weight of 299.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-(trifluoromethyl)hept-5-en-2-amine.
| Compound Name | N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-(trifluoromethyl)hept-5-en-2-amine |
|---|---|
| PubChem CID | 121451127 |
| Molecular Formula | C10H13F8N |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-(trifluoromethyl)hept-5-en-2-amine |
| SMILES | CC(CCC=C(C(F)(F)F)C(F)(F)F)NCC(F)F |
| InChI | InChI=1S/C10H13F8N/c1-6(19-5-8(11)12)3-2-4-7(9(13,14)15)10(16,17)18/h4,6,8,19H,2-3,5H2,1H3 |
| InChIKey | JCYOEEDOCGOPGF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|