About N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine
N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine (PubChem CID 121451135) has the molecular formula C11H17F6N
and a molecular weight of 277.25 g/mol. Its IUPAC name is N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine |
| PubChem CID | 121451135 |
| Molecular Formula | C11H17F6N |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine |
| SMILES | CC(CCCC(C(F)(F)F)C(F)(F)F)NC1CC1 |
| InChI | InChI=1S/C11H17F6N/c1-7(18-8-5-6-8)3-2-4-9(10(12,13)14)11(15,16)17/h7-9,18H,2-6H2,1H3 |
| InChIKey | RRQNFRDTWDLACM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine?
The IUPAC name of N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine (CID 121451135) is N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine.
What is the SMILES notation for N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine?
The canonical SMILES for N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine is CC(CCCC(C(F)(F)F)C(F)(F)F)NC1CC1.
What is the InChIKey of N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine?
The InChIKey is RRQNFRDTWDLACM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F6N/c1-7(18-8-5-6-8)3-2-4-9(10(12,13)14)11(15,16)17/h7-9,18H,2-6H2,1H3.
What are the key properties of N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine?
N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine has a molecular weight of 277.25 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7,7,7-trifluoro-6-(trifluoromethyl)heptan-2-yl]cyclopropanamine is sourced from PubChem (CID 121451135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).