C18H22BrN3O2 — CID 121451146
1-[[5-bromo-2-(3-phenoxypropoxy)phenyl]methyl]-1-methylguanidine (PubChem CID 121451146) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-[[5-bromo-2-(3-phenoxypropoxy)phenyl]methyl]-1-methylguanidine.
| Compound Name | 1-[[5-bromo-2-(3-phenoxypropoxy)phenyl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 121451146 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[[5-bromo-2-(3-phenoxypropoxy)phenyl]methyl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)Cc1cc(Br)ccc1OCCCOc1ccccc1 |
| InChI | InChI=1S/C18H22BrN3O2/c1-22(18(20)21)13-14-12-15(19)8-9-17(14)24-11-5-10-23-16-6-3-2-4-7-16/h2-4,6-9,12H,5,10-11,13H2,1H3,(H3,20,21) |
| InChIKey | QEKWGYCTPMMUSX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|