C15H30N4 — CID 121451192
N-(4,5-dihydro-1H-imidazol-2-yl)-N'-[(2R)-6-methylhept-5-en-2-yl]butane-1,4-diamine (PubChem CID 121451192) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-N'-[(2R)-6-methylhept-5-en-2-yl]butane-1,4-diamine.
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-N'-[(2R)-6-methylhept-5-en-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 121451192 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-N'-[(2R)-6-methylhept-5-en-2-yl]butane-1,4-diamine |
| SMILES | CC(C)=CCC[C@@H](C)NCCCCNC1=NCCN1 |
| InChI | InChI=1S/C15H30N4/c1-13(2)7-6-8-14(3)16-9-4-5-10-17-15-18-11-12-19-15/h7,14,16H,4-6,8-12H2,1-3H3,(H2,17,18,19)/t14-/m1/s1 |
| InChIKey | HIWDESYMAHRPAK-CQSZACIVSA-N |
| XLogP | 2.04 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|