About N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide
N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide (PubChem CID 121451366) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide |
| PubChem CID | 121451366 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide |
| SMILES | C/C=C/C(C)N/C=N/CCC |
| InChI | InChI=1S/C9H18N2/c1-4-6-9(3)11-8-10-7-5-2/h4,6,8-9H,5,7H2,1-3H3,(H,10,11)/b6-4+ |
| InChIKey | OQNFWERNHHDOHC-GQCTYLIASA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide?
The IUPAC name of N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide (CID 121451366) is N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide.
What is the SMILES notation for N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide?
The canonical SMILES for N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide is C/C=C/C(C)N/C=N/CCC.
What is the InChIKey of N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide?
The InChIKey is OQNFWERNHHDOHC-GQCTYLIASA-N. The full InChI is InChI=1S/C9H18N2/c1-4-6-9(3)11-8-10-7-5-2/h4,6,8-9H,5,7H2,1-3H3,(H,10,11)/b6-4+.
What are the key properties of N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide?
N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide has a molecular weight of 154.26 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-pent-3-en-2-yl]-N'-propylmethanimidamide is sourced from PubChem (CID 121451366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).