C10H14F3NO — CID 121451616
4,4,4-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 121451616) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 121451616 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | CC1=CCN(C(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO/c1-8-3-6-14(7-4-8)9(15)2-5-10(11,12)13/h3H,2,4-7H2,1H3 |
| InChIKey | KHZFMDOPJISQMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|