About cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate
cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 121451620) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 121451620 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1=CCN(C(=O)OCC#N)CC1 |
| InChI | InChI=1S/C9H12N2O2/c1-8-2-5-11(6-3-8)9(12)13-7-4-10/h2H,3,5-7H2,1H3 |
| InChIKey | ZYHYSUUPVAVSHQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 121451620) is cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is CC1=CCN(C(=O)OCC#N)CC1.
What is the InChIKey of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is ZYHYSUUPVAVSHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-8-2-5-11(6-3-8)9(12)13-7-4-10/h2H,3,5-7H2,1H3.
What are the key properties of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 180.21 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 121451620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).