About 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate
2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 121451627) has the molecular formula C9H13F2NO2
and a molecular weight of 205.20 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 121451627 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1=CCN(C(=O)OCC(F)F)CC1 |
| InChI | InChI=1S/C9H13F2NO2/c1-7-2-4-12(5-3-7)9(13)14-6-8(10)11/h2,8H,3-6H2,1H3 |
| InChIKey | UMCLJOKCCRIYSV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 121451627) is 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is CC1=CCN(C(=O)OCC(F)F)CC1.
What is the InChIKey of 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is UMCLJOKCCRIYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2/c1-7-2-4-12(5-3-7)9(13)14-6-8(10)11/h2,8H,3-6H2,1H3.
What are the key properties of 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 205.20 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 121451627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).