About 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one
4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one (PubChem CID 121451635) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one.
Molecular Properties
| Compound Name | 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one |
| PubChem CID | 121451635 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one |
| SMILES | CC1=CCN(C(=O)CCC(C)C)CC1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)4-5-12(14)13-8-6-11(3)7-9-13/h6,10H,4-5,7-9H2,1-3H3 |
| InChIKey | MWAXOUMUMPDGLN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one?
The IUPAC name of 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one (CID 121451635) is 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one.
What is the SMILES notation for 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one?
The canonical SMILES for 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one is CC1=CCN(C(=O)CCC(C)C)CC1.
What is the InChIKey of 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one?
The InChIKey is MWAXOUMUMPDGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)4-5-12(14)13-8-6-11(3)7-9-13/h6,10H,4-5,7-9H2,1-3H3.
What are the key properties of 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one?
4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one has a molecular weight of 195.31 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)pentan-1-one is sourced from PubChem (CID 121451635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).