About (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone
(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone (PubChem CID 121451640) has the molecular formula C15H18F3N3O
and a molecular weight of 313.32 g/mol. Its IUPAC name is (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone.
Molecular Properties
| Compound Name | (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone |
| PubChem CID | 121451640 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone |
| SMILES | CN1CCC2(CC1)CN(C(=O)c1ccnc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C15H18F3N3O/c1-20-6-3-14(4-7-20)9-21(10-14)13(22)11-2-5-19-12(8-11)15(16,17)18/h2,5,8H,3-4,6-7,9-10H2,1H3 |
| InChIKey | WBQCMJIEFZDXJZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone?
The IUPAC name of (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone (CID 121451640) is (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone.
What is the SMILES notation for (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone?
The canonical SMILES for (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone is CN1CCC2(CC1)CN(C(=O)c1ccnc(C(F)(F)F)c1)C2.
What is the InChIKey of (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone?
The InChIKey is WBQCMJIEFZDXJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N3O/c1-20-6-3-14(4-7-20)9-21(10-14)13(22)11-2-5-19-12(8-11)15(16,17)18/h2,5,8H,3-4,6-7,9-10H2,1H3.
What are the key properties of (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone?
(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone has a molecular weight of 313.32 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-[2-(trifluoromethyl)-4-pyridinyl]methanone is sourced from PubChem (CID 121451640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).