C19H23N5O4 — CID 121451957
4-[4-[(5-acetamido-2-methoxy-4-pyridinyl)amino]phenyl]piperazine-1-carboxylic acid (PubChem CID 121451957) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-[4-[(5-acetamido-2-methoxy-4-pyridinyl)amino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[(5-acetamido-2-methoxy-4-pyridinyl)amino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 121451957 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[4-[(5-acetamido-2-methoxy-4-pyridinyl)amino]phenyl]piperazine-1-carboxylic acid |
| SMILES | COc1cc(Nc2ccc(N3CCN(C(=O)O)CC3)cc2)c(NC(C)=O)cn1 |
| InChI | InChI=1S/C19H23N5O4/c1-13(25)21-17-12-20-18(28-2)11-16(17)22-14-3-5-15(6-4-14)23-7-9-24(10-8-23)19(26)27/h3-6,11-12H,7-10H2,1-2H3,(H,20,22)(H,21,25)(H,26,27) |
| InChIKey | DWLGGRDJJYCQLP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|