C12H19N3O — CID 121452475
1,6-dimethyl-5-(3-methylpiperazin-1-yl)pyridin-2-one (PubChem CID 121452475) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1,6-dimethyl-5-(3-methylpiperazin-1-yl)pyridin-2-one.
| Compound Name | 1,6-dimethyl-5-(3-methylpiperazin-1-yl)pyridin-2-one |
|---|---|
| PubChem CID | 121452475 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1,6-dimethyl-5-(3-methylpiperazin-1-yl)pyridin-2-one |
| SMILES | Cc1c(N2CCNC(C)C2)ccc(=O)n1C |
| InChI | InChI=1S/C12H19N3O/c1-9-8-15(7-6-13-9)11-4-5-12(16)14(3)10(11)2/h4-5,9,13H,6-8H2,1-3H3 |
| InChIKey | IKPSYMTVRXCNSZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |