C26H26F2N4 — CID 121453020
N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine (PubChem CID 121453020) has the molecular formula C26H26F2N4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 121453020 |
| Molecular Formula | C26H26F2N4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C26H26F2N4/c1-3-32(4-2)14-13-29-26-21-16-19-7-5-6-8-20(19)17-24(21)30-25(31-26)12-10-18-9-11-22(27)23(28)15-18/h5-12,15-17H,3-4,13-14H2,1-2H3,(H,29,30,31)/b12-10+ |
| InChIKey | KCOYFMRVPFMSPT-ZRDIBKRKSA-N |
| XLogP | 5.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|