C25H24F2N4 — CID 121453028
N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121453028) has the molecular formula C25H24F2N4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453028 |
| Molecular Formula | C25H24F2N4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C25H24F2N4/c1-31(2)13-5-12-28-25-20-15-18-6-3-4-7-19(18)16-23(20)29-24(30-25)11-9-17-8-10-21(26)22(27)14-17/h3-4,6-11,14-16H,5,12-13H2,1-2H3,(H,28,29,30)/b11-9+ |
| InChIKey | FAHOTTRIEKWQLF-PKNBQFBNSA-N |
| XLogP | 5.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|