C21H21BrF2N4 — CID 121453029
N-[6-bromo-2-[(E)-2-(3,4-difluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121453029) has the molecular formula C21H21BrF2N4 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[6-bromo-2-[(E)-2-(3,4-difluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-bromo-2-[(E)-2-(3,4-difluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453029 |
| Molecular Formula | C21H21BrF2N4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[6-bromo-2-[(E)-2-(3,4-difluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C21H21BrF2N4/c1-28(2)11-3-10-25-21-16-13-15(22)6-8-19(16)26-20(27-21)9-5-14-4-7-17(23)18(24)12-14/h4-9,12-13H,3,10-11H2,1-2H3,(H,25,26,27)/b9-5+ |
| InChIKey | YWIRIDSOBLIDPR-WEVVVXLNSA-N |
| XLogP | 5.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|