C25H28N4S — CID 121453032
N',N'-diethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121453032) has the molecular formula C25H28N4S and a molecular weight of 416.59 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121453032 |
| Molecular Formula | C25H28N4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N',N'-diethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2cccs2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C25H28N4S/c1-3-29(4-2)15-8-14-26-25-22-17-19-9-5-6-10-20(19)18-23(22)27-24(28-25)13-12-21-11-7-16-30-21/h5-7,9-13,16-18H,3-4,8,14-15H2,1-2H3,(H,26,27,28)/b13-12+ |
| InChIKey | YAZSOVPYRSJABJ-OUKQBFOZSA-N |
| XLogP | 6.16 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|