C24H29ClN4 — CID 121453039
N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121453039) has the molecular formula C24H29ClN4 and a molecular weight of 408.98 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453039 |
| Molecular Formula | C24H29ClN4 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(C)c1ccc(/C=C/c2nc(NCCCN(C)C)c3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C24H29ClN4/c1-17(2)19-9-6-18(7-10-19)8-13-23-27-22-12-11-20(25)16-21(22)24(28-23)26-14-5-15-29(3)4/h6-13,16-17H,5,14-15H2,1-4H3,(H,26,27,28)/b13-8+ |
| InChIKey | ATCWOUWYXWAFKT-MDWZMJQESA-N |
| XLogP | 5.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|