C23H24N4S — CID 121453043
N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121453043) has the molecular formula C23H24N4S and a molecular weight of 388.54 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121453043 |
| Molecular Formula | C23H24N4S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2cccs2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C23H24N4S/c1-27(2)13-6-12-24-23-20-15-17-7-3-4-8-18(17)16-21(20)25-22(26-23)11-10-19-9-5-14-28-19/h3-5,7-11,14-16H,6,12-13H2,1-2H3,(H,24,25,26)/b11-10+ |
| InChIKey | PDYADBYCLHMFEE-ZHACJKMWSA-N |
| XLogP | 5.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|