C21H25ClN4S — CID 121453077
N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 121453077) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453077 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2cccs2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H25ClN4S/c1-3-26(4-2)13-6-12-23-21-18-15-16(22)8-10-19(18)24-20(25-21)11-9-17-7-5-14-27-17/h5,7-11,14-15H,3-4,6,12-13H2,1-2H3,(H,23,24,25)/b11-9+ |
| InChIKey | ZMOIJNLEECMATK-PKNBQFBNSA-N |
| XLogP | 5.66 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|