C27H29ClN4 — CID 121453078
N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 121453078) has the molecular formula C27H29ClN4 and a molecular weight of 445.01 g/mol. Its IUPAC name is N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453078 |
| Molecular Formula | C27H29ClN4 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C27H29ClN4/c1-3-32(4-2)17-7-16-29-27-24-18-21-8-5-6-9-22(21)19-25(24)30-26(31-27)15-12-20-10-13-23(28)14-11-20/h5-6,8-15,18-19H,3-4,7,16-17H2,1-2H3,(H,29,30,31)/b15-12+ |
| InChIKey | WMCBJYZKRPMMAZ-NTCAYCPXSA-N |
| XLogP | 6.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|