C25H25FN4 — CID 121453094
N-[2-[(E)-2-(4-fluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121453094) has the molecular formula C25H25FN4 and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[2-[(E)-2-(4-fluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[(E)-2-(4-fluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453094 |
| Molecular Formula | C25H25FN4 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-[2-[(E)-2-(4-fluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2ccc(F)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C25H25FN4/c1-30(2)15-5-14-27-25-22-16-19-6-3-4-7-20(19)17-23(22)28-24(29-25)13-10-18-8-11-21(26)12-9-18/h3-4,6-13,16-17H,5,14-15H2,1-2H3,(H,27,28,29)/b13-10+ |
| InChIKey | QOHCMDWMTLDWRT-JLHYYAGUSA-N |
| XLogP | 5.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|