C22H22N4S — CID 121453101
N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine (PubChem CID 121453101) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 121453101 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N',N'-dimethyl-N-[2-[(E)-2-thiophen-2-ylethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(/C=C/c2cccs2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C22H22N4S/c1-26(2)12-11-23-22-19-14-16-6-3-4-7-17(16)15-20(19)24-21(25-22)10-9-18-8-5-13-27-18/h3-10,13-15H,11-12H2,1-2H3,(H,23,24,25)/b10-9+ |
| InChIKey | GAEVEHHBAUZFLY-MDZDMXLPSA-N |
| XLogP | 4.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|