C24H29FN4O — CID 121453120
N',N'-diethyl-N-[6-fluoro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121453120) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is N',N'-diethyl-N-[6-fluoro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[6-fluoro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121453120 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N',N'-diethyl-N-[6-fluoro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2ccc(OC)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C24H29FN4O/c1-4-29(5-2)16-6-15-26-24-21-17-19(25)10-13-22(21)27-23(28-24)14-9-18-7-11-20(30-3)12-8-18/h7-14,17H,4-6,15-16H2,1-3H3,(H,26,27,28)/b14-9+ |
| InChIKey | WLLCAWXAXATDJG-NTEUORMPSA-N |
| XLogP | 5.09 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|