C22H26N4O2S — CID 121453130
N',N'-dimethyl-N-[2-[(E)-2-(4-methylsulfonylphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121453130) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[(E)-2-(4-methylsulfonylphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[(E)-2-(4-methylsulfonylphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121453130 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N',N'-dimethyl-N-[2-[(E)-2-(4-methylsulfonylphenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2ccc(S(C)(=O)=O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H26N4O2S/c1-26(2)16-6-15-23-22-19-7-4-5-8-20(19)24-21(25-22)14-11-17-9-12-18(13-10-17)29(3,27)28/h4-5,7-14H,6,15-16H2,1-3H3,(H,23,24,25)/b14-11+ |
| InChIKey | VIHPXMUIWSPNMV-SDNWHVSQSA-N |
| XLogP | 3.57 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|