C27H28F2N4 — CID 121453141
N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 121453141) has the molecular formula C27H28F2N4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453141 |
| Molecular Formula | C27H28F2N4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C27H28F2N4/c1-3-33(4-2)15-7-14-30-27-22-17-20-8-5-6-9-21(20)18-25(22)31-26(32-27)13-11-19-10-12-23(28)24(29)16-19/h5-6,8-13,16-18H,3-4,7,14-15H2,1-2H3,(H,30,31,32)/b13-11+ |
| InChIKey | FDPFACNQHUGBJG-ACCUITESSA-N |
| XLogP | 6.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|